C10H17N3O — CID 106415135
N-(1,2-oxazol-5-ylmethyl)-1-piperidin-2-ylmethanamine (PubChem CID 106415135) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-1-piperidin-2-ylmethanamine.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-1-piperidin-2-ylmethanamine |
|---|---|
| PubChem CID | 106415135 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-1-piperidin-2-ylmethanamine |
| SMILES | c1cc(CNCC2CCCCN2)on1 |
| InChI | InChI=1S/C10H17N3O/c1-2-5-12-9(3-1)7-11-8-10-4-6-13-14-10/h4,6,9,11-12H,1-3,5,7-8H2 |
| InChIKey | CINFCBVGRFGVIE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |