C22H23NO3 — CID 10641530
(1S,2S,8R)-2-phenylmethoxy-1-(phenylmethoxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one (PubChem CID 10641530) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (1S,2S,8R)-2-phenylmethoxy-1-(phenylmethoxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one.
| Compound Name | (1S,2S,8R)-2-phenylmethoxy-1-(phenylmethoxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 10641530 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (1S,2S,8R)-2-phenylmethoxy-1-(phenylmethoxymethyl)-1,2,5,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1[C@@H](OCc2ccccc2)[C@H](COCc2ccccc2)[C@H]2C=CCN12 |
| InChI | InChI=1S/C22H23NO3/c24-22-21(26-15-18-10-5-2-6-11-18)19(20-12-7-13-23(20)22)16-25-14-17-8-3-1-4-9-17/h1-12,19-21H,13-16H2/t19-,20-,21+/m1/s1 |
| InChIKey | QBVRJNKAJWURSX-NJYVYQBISA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|