About N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide
N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide (PubChem CID 106415332) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide |
| PubChem CID | 106415332 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1noc(C)n1 |
| InChI | InChI=1S/C8H11N3O2/c1-3-8(12)9-5-4-7-10-6(2)13-11-7/h3H,1,4-5H2,2H3,(H,9,12) |
| InChIKey | YOLPTIDDZLBZRX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide?
The IUPAC name of N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide (CID 106415332) is N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide?
The canonical SMILES for N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide is C=CC(=O)NCCc1noc(C)n1.
What is the InChIKey of N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide?
The InChIKey is YOLPTIDDZLBZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-3-8(12)9-5-4-7-10-6(2)13-11-7/h3H,1,4-5H2,2H3,(H,9,12).
What are the key properties of N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide?
N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide has a molecular weight of 181.19 g/mol, XLogP of 0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]prop-2-enamide is sourced from PubChem (CID 106415332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).