C9H15N3O2 — CID 106415574
1-butyl-3-(1,2-oxazol-5-ylmethyl)urea (PubChem CID 106415574) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-butyl-3-(1,2-oxazol-5-ylmethyl)urea.
| Compound Name | 1-butyl-3-(1,2-oxazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 106415574 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-butyl-3-(1,2-oxazol-5-ylmethyl)urea |
| SMILES | CCCCNC(=O)NCc1ccno1 |
| InChI | InChI=1S/C9H15N3O2/c1-2-3-5-10-9(13)11-7-8-4-6-12-14-8/h4,6H,2-3,5,7H2,1H3,(H2,10,11,13) |
| InChIKey | ASCVUPROMXNBPX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|