C6H8N2O3 — CID 106415587
methyl N-(1,2-oxazol-5-ylmethyl)carbamate (PubChem CID 106415587) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is methyl N-(1,2-oxazol-5-ylmethyl)carbamate.
| Compound Name | methyl N-(1,2-oxazol-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 106415587 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | methyl N-(1,2-oxazol-5-ylmethyl)carbamate |
| SMILES | COC(=O)NCc1ccno1 |
| InChI | InChI=1S/C6H8N2O3/c1-10-6(9)7-4-5-2-3-8-11-5/h2-3H,4H2,1H3,(H,7,9) |
| InChIKey | MRYMDHKJAFBJIV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |