C14H15N5O2 — CID 106416440
2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 106416440) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 106416440 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1noc(CCNCc2cc(=O)n3ccccc3n2)n1 |
| InChI | InChI=1S/C14H15N5O2/c1-10-16-13(21-18-10)5-6-15-9-11-8-14(20)19-7-3-2-4-12(19)17-11/h2-4,7-8,15H,5-6,9H2,1H3 |
| InChIKey | OOPHNAKDIGDHDP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|