C10H17N3O2 — CID 106416982
(2S)-2-amino-4-methyl-N-(1,2-oxazol-5-ylmethyl)pentanamide (PubChem CID 106416982) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-(1,2-oxazol-5-ylmethyl)pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-(1,2-oxazol-5-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 106416982 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-(1,2-oxazol-5-ylmethyl)pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCc1ccno1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)5-9(11)10(14)12-6-8-3-4-13-15-8/h3-4,7,9H,5-6,11H2,1-2H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | YNNAXVRYZBJZQV-VIFPVBQESA-N |
| XLogP | 0.66 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |