C10H15N3O2 — CID 106417230
(3R)-N-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxamide (PubChem CID 106417230) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (3R)-N-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 106417230 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3R)-N-(1,2-oxazol-5-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccno1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C10H15N3O2/c14-10(8-2-1-4-11-6-8)12-7-9-3-5-13-15-9/h3,5,8,11H,1-2,4,6-7H2,(H,12,14)/t8-/m1/s1 |
| InChIKey | SEMFHQWUAHQLGL-MRVPVSSYSA-N |
| XLogP | 0.29 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |