About 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol
1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol (PubChem CID 106417397) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol |
| PubChem CID | 106417397 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNCc1ccno1 |
| InChI | InChI=1S/C11H21N3O2/c1-3-14(4-2)9-10(15)7-12-8-11-5-6-13-16-11/h5-6,10,12,15H,3-4,7-9H2,1-2H3 |
| InChIKey | VNRYSLMMUSLCRM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol?
The IUPAC name of 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol (CID 106417397) is 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol.
What is the SMILES notation for 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol?
The canonical SMILES for 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol is CCN(CC)CC(O)CNCc1ccno1.
What is the InChIKey of 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol?
The InChIKey is VNRYSLMMUSLCRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-3-14(4-2)9-10(15)7-12-8-11-5-6-13-16-11/h5-6,10,12,15H,3-4,7-9H2,1-2H3.
What are the key properties of 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol?
1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol has a molecular weight of 227.31 g/mol, XLogP of 0.47, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethylamino)-3-(1,2-oxazol-5-ylmethylamino)propan-2-ol is sourced from PubChem (CID 106417397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).