C10H14N4O — CID 106417768
2-(2-methylimidazol-1-yl)-N-(1,2-oxazol-5-ylmethyl)ethanamine (PubChem CID 106417768) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(2-methylimidazol-1-yl)-N-(1,2-oxazol-5-ylmethyl)ethanamine.
| Compound Name | 2-(2-methylimidazol-1-yl)-N-(1,2-oxazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106417768 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(2-methylimidazol-1-yl)-N-(1,2-oxazol-5-ylmethyl)ethanamine |
| SMILES | Cc1nccn1CCNCc1ccno1 |
| InChI | InChI=1S/C10H14N4O/c1-9-12-5-7-14(9)6-4-11-8-10-2-3-13-15-10/h2-3,5,7,11H,4,6,8H2,1H3 |
| InChIKey | ZDLAFTGKRNQJLY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|