About 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol
4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol (PubChem CID 106418044) has the molecular formula C8H12N2O4S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol |
| PubChem CID | 106418044 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCc2ccno2)C1 |
| InChI | InChI=1S/C8H12N2O4S/c11-8-5-15(12,13)4-7(8)9-3-6-1-2-10-14-6/h1-2,7-9,11H,3-5H2 |
| InChIKey | AEXKVVFXUQHIAQ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol (CID 106418044) is 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol is O=S1(=O)CC(O)C(NCc2ccno2)C1.
What is the InChIKey of 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol?
The InChIKey is AEXKVVFXUQHIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S/c11-8-5-15(12,13)4-7(8)9-3-6-1-2-10-14-6/h1-2,7-9,11H,3-5H2.
What are the key properties of 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol?
4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol has a molecular weight of 232.26 g/mol, XLogP of -1.08, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-oxazol-5-ylmethylamino)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 106418044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).