About 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine
2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine (PubChem CID 106418263) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine |
| PubChem CID | 106418263 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine |
| SMILES | CC1C(N)CCN(Cc2ccno2)C1C |
| InChI | InChI=1S/C11H19N3O/c1-8-9(2)14(6-4-11(8)12)7-10-3-5-13-15-10/h3,5,8-9,11H,4,6-7,12H2,1-2H3 |
| InChIKey | UIOLZNRZEKUJSB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine?
The IUPAC name of 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine (CID 106418263) is 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine.
What is the SMILES notation for 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine?
The canonical SMILES for 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine is CC1C(N)CCN(Cc2ccno2)C1C.
What is the InChIKey of 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine?
The InChIKey is UIOLZNRZEKUJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-8-9(2)14(6-4-11(8)12)7-10-3-5-13-15-10/h3,5,8-9,11H,4,6-7,12H2,1-2H3.
What are the key properties of 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine?
2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine has a molecular weight of 209.29 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-(1,2-oxazol-5-ylmethyl)piperidin-4-amine is sourced from PubChem (CID 106418263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).