C8H11F3N4O2 — CID 106418420
3,3,3-trifluoro-N'-hydroxy-2-[(1,2-oxazol-5-ylmethylamino)methyl]propanimidamide (PubChem CID 106418420) has the molecular formula C8H11F3N4O2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(1,2-oxazol-5-ylmethylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(1,2-oxazol-5-ylmethylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 106418420 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(1,2-oxazol-5-ylmethylamino)methyl]propanimidamide |
| SMILES | NC(=NO)C(CNCc1ccno1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2/c9-8(10,11)6(7(12)15-16)4-13-3-5-1-2-14-17-5/h1-2,6,13,16H,3-4H2,(H2,12,15) |
| InChIKey | JRKTWPGRWSUSOX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|