About 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine
5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine (PubChem CID 106418986) has the molecular formula C9H9FN4O
and a molecular weight of 208.20 g/mol. Its IUPAC name is 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 106418986 |
| Molecular Formula | C9H9FN4O |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1ncnc(NCc2ccno2)c1F |
| InChI | InChI=1S/C9H9FN4O/c1-6-8(10)9(13-5-12-6)11-4-7-2-3-14-15-7/h2-3,5H,4H2,1H3,(H,11,12,13) |
| InChIKey | QCWCZSQQXPMHLK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine (CID 106418986) is 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine is Cc1ncnc(NCc2ccno2)c1F.
What is the InChIKey of 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine?
The InChIKey is QCWCZSQQXPMHLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4O/c1-6-8(10)9(13-5-12-6)11-4-7-2-3-14-15-7/h2-3,5H,4H2,1H3,(H,11,12,13).
What are the key properties of 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine?
5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine has a molecular weight of 208.20 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-N-(1,2-oxazol-5-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 106418986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).