C11H10ClN5OS — CID 106419422
6-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 106419422) has the molecular formula C11H10ClN5OS and a molecular weight of 295.75 g/mol. Its IUPAC name is 6-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 106419422 |
| Molecular Formula | C11H10ClN5OS |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 6-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1nc(CCn2c(=S)[nH]c3cc(Cl)cnc32)no1 |
| InChI | InChI=1S/C11H10ClN5OS/c1-6-14-9(16-18-6)2-3-17-10-8(15-11(17)19)4-7(12)5-13-10/h4-5H,2-3H2,1H3,(H,15,19) |
| InChIKey | FBCCPPLEJZEEGA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|