C9H12F3N3O3 — CID 106419567
3,3,3-trifluoro-2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanoic acid (PubChem CID 106419567) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanoic acid |
|---|---|
| PubChem CID | 106419567 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]propanoic acid |
| SMILES | Cc1nc(CCNCC(C(=O)O)C(F)(F)F)no1 |
| InChI | InChI=1S/C9H12F3N3O3/c1-5-14-7(15-18-5)2-3-13-4-6(8(16)17)9(10,11)12/h6,13H,2-4H2,1H3,(H,16,17) |
| InChIKey | OMPLLUHFTKUDPN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|