About (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid
(E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid (PubChem CID 106419610) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid |
| PubChem CID | 106419610 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid |
| SMILES | Cc1nc(CCNC/C=C/C(=O)O)no1 |
| InChI | InChI=1S/C9H13N3O3/c1-7-11-8(12-15-7)4-6-10-5-2-3-9(13)14/h2-3,10H,4-6H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | PSFIMWZJNKUENY-NSCUHMNNSA-N |
| XLogP | 0.15 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The IUPAC name of (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid (CID 106419610) is (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid.
What is the SMILES notation for (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The canonical SMILES for (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid is Cc1nc(CCNC/C=C/C(=O)O)no1.
What is the InChIKey of (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
The InChIKey is PSFIMWZJNKUENY-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H13N3O3/c1-7-11-8(12-15-7)4-6-10-5-2-3-9(13)14/h2-3,10H,4-6H2,1H3,(H,13,14)/b3-2+.
What are the key properties of (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid?
(E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid has a molecular weight of 211.22 g/mol, XLogP of 0.15, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]but-2-enoic acid is sourced from PubChem (CID 106419610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).