About 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate
3-(1H-imidazol-5-yl)propyl 3-iodobenzoate (PubChem CID 10641962) has the molecular formula C13H13IN2O2
and a molecular weight of 356.16 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate |
| PubChem CID | 10641962 |
| Molecular Formula | C13H13IN2O2 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate |
| SMILES | O=C(OCCCc1cnc[nH]1)c1cccc(I)c1 |
| InChI | InChI=1S/C13H13IN2O2/c14-11-4-1-3-10(7-11)13(17)18-6-2-5-12-8-15-9-16-12/h1,3-4,7-9H,2,5-6H2,(H,15,16) |
| InChIKey | DJJALMUYLBLGGW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate?
The IUPAC name of 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate (CID 10641962) is 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate.
What is the SMILES notation for 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate?
The canonical SMILES for 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate is O=C(OCCCc1cnc[nH]1)c1cccc(I)c1.
What is the InChIKey of 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate?
The InChIKey is DJJALMUYLBLGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IN2O2/c14-11-4-1-3-10(7-11)13(17)18-6-2-5-12-8-15-9-16-12/h1,3-4,7-9H,2,5-6H2,(H,15,16).
What are the key properties of 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate?
3-(1H-imidazol-5-yl)propyl 3-iodobenzoate has a molecular weight of 356.16 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)propyl 3-iodobenzoate is sourced from PubChem (CID 10641962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).