About (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid
(E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid (PubChem CID 106419702) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid |
| PubChem CID | 106419702 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid |
| SMILES | Cc1noc(CCN/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C8H11N3O3/c1-6-10-7(14-11-6)2-4-9-5-3-8(12)13/h3,5,9H,2,4H2,1H3,(H,12,13)/b5-3+ |
| InChIKey | RLNMMGNABPOPIA-HWKANZROSA-N |
| XLogP | 0.11 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid?
The IUPAC name of (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid (CID 106419702) is (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid?
The canonical SMILES for (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid is Cc1noc(CCN/C=C/C(=O)O)n1.
What is the InChIKey of (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid?
The InChIKey is RLNMMGNABPOPIA-HWKANZROSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-6-10-7(14-11-6)2-4-9-5-3-8(12)13/h3,5,9H,2,4H2,1H3,(H,12,13)/b5-3+.
What are the key properties of (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid?
(E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid has a molecular weight of 197.19 g/mol, XLogP of 0.11, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]prop-2-enoic acid is sourced from PubChem (CID 106419702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).