C11H17N3O3 — CID 106419718
ethyl 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]prop-2-enoate (PubChem CID 106419718) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 106419718 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | ethyl 2-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]prop-2-enoate |
| SMILES | C=C(CNCCc1nc(C)no1)C(=O)OCC |
| InChI | InChI=1S/C11H17N3O3/c1-4-16-11(15)8(2)7-12-6-5-10-13-9(3)14-17-10/h12H,2,4-7H2,1,3H3 |
| InChIKey | UVZYHWPAWLVDSA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|