C18H32O5Si — CID 10642029
[(3aR,6S,6aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate (PubChem CID 10642029) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is [(3aR,6S,6aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,6S,6aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 10642029 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(3aR,6S,6aS)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(CCO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C18H32O5Si/c1-12(19)21-14-11-13(15-16(14)23-18(5,6)22-15)9-10-20-24(7,8)17(2,3)4/h11,14-16H,9-10H2,1-8H3/t14-,15+,16-/m0/s1 |
| InChIKey | SMEYWTCQBOVUEE-XHSDSOJGSA-N |
| XLogP | 3.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|