C20H40O3Si — CID 10642035
tri(propan-2-yl)-[(1R)-1-[(4S,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]but-3-enoxy]silane (PubChem CID 10642035) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is tri(propan-2-yl)-[(1R)-1-[(4S,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]but-3-enoxy]silane.
| Compound Name | tri(propan-2-yl)-[(1R)-1-[(4S,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]but-3-enoxy]silane |
|---|---|
| PubChem CID | 10642035 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | tri(propan-2-yl)-[(1R)-1-[(4S,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]but-3-enoxy]silane |
| SMILES | C=CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1COC(C)(C)O[C@H]1C |
| InChI | InChI=1S/C20H40O3Si/c1-11-12-19(18-13-21-20(9,10)22-17(18)8)23-24(14(2)3,15(4)5)16(6)7/h11,14-19H,1,12-13H2,2-10H3/t17-,18-,19+/m0/s1 |
| InChIKey | OYHBDTLKMFFMCX-GBESFXJTSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|