C9H13ClN4O3 — CID 106421413
3-chloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylcarbamoyl]propanamide (PubChem CID 106421413) has the molecular formula C9H13ClN4O3 and a molecular weight of 260.68 g/mol. Its IUPAC name is 3-chloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylcarbamoyl]propanamide.
| Compound Name | 3-chloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 106421413 |
| Molecular Formula | C9H13ClN4O3 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-chloro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylcarbamoyl]propanamide |
| SMILES | Cc1noc(CCNC(=O)NC(=O)CCCl)n1 |
| InChI | InChI=1S/C9H13ClN4O3/c1-6-12-8(17-14-6)3-5-11-9(16)13-7(15)2-4-10/h2-5H2,1H3,(H2,11,13,15,16) |
| InChIKey | UXQSTNWSVATSKW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|