About 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione
1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione (PubChem CID 106422160) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione |
| PubChem CID | 106422160 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1CN(Cc2ccno2)C(=O)CN1 |
| InChI | InChI=1S/C8H9N3O3/c12-7-5-11(8(13)3-9-7)4-6-1-2-10-14-6/h1-2H,3-5H2,(H,9,12) |
| InChIKey | HKTKDJYSTDFXQZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione?
The IUPAC name of 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione (CID 106422160) is 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione.
What is the SMILES notation for 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione?
The canonical SMILES for 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione is O=C1CN(Cc2ccno2)C(=O)CN1.
What is the InChIKey of 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione?
The InChIKey is HKTKDJYSTDFXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c12-7-5-11(8(13)3-9-7)4-6-1-2-10-14-6/h1-2H,3-5H2,(H,9,12).
What are the key properties of 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione?
1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione has a molecular weight of 195.18 g/mol, XLogP of -0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-oxazol-5-ylmethyl)piperazine-2,5-dione is sourced from PubChem (CID 106422160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).