C13H19N3O3 — CID 106422227
3-tert-butyl-1-(1,2-oxazol-5-ylmethyl)-1,4-diazepane-2,5-dione (PubChem CID 106422227) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-tert-butyl-1-(1,2-oxazol-5-ylmethyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-tert-butyl-1-(1,2-oxazol-5-ylmethyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 106422227 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-tert-butyl-1-(1,2-oxazol-5-ylmethyl)-1,4-diazepane-2,5-dione |
| SMILES | CC(C)(C)C1NC(=O)CCN(Cc2ccno2)C1=O |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)11-12(18)16(7-5-10(17)15-11)8-9-4-6-14-19-9/h4,6,11H,5,7-8H2,1-3H3,(H,15,17) |
| InChIKey | GGBKFZHUVRCFOR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |