About 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione
5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione (PubChem CID 106422411) has the molecular formula C8H6FN3O4
and a molecular weight of 227.15 g/mol. Its IUPAC name is 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione |
| PubChem CID | 106422411 |
| Molecular Formula | C8H6FN3O4 |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccno2)c(O)c1F |
| InChI | InChI=1S/C8H6FN3O4/c9-5-6(13)11-8(15)12(7(5)14)3-4-1-2-10-16-4/h1-2,14H,3H2,(H,11,13,15) |
| InChIKey | MEQLQEXIEUKDJK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione (CID 106422411) is 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione is O=c1[nH]c(=O)n(Cc2ccno2)c(O)c1F.
What is the InChIKey of 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The InChIKey is MEQLQEXIEUKDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O4/c9-5-6(13)11-8(15)12(7(5)14)3-4-1-2-10-16-4/h1-2,14H,3H2,(H,11,13,15).
What are the key properties of 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione has a molecular weight of 227.15 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-hydroxy-1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 106422411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).