C7H5F5N2O2 — CID 106423353
2,2,3,3,3-pentafluoro-N-(1,2-oxazol-5-ylmethyl)propanamide (PubChem CID 106423353) has the molecular formula C7H5F5N2O2 and a molecular weight of 244.12 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(1,2-oxazol-5-ylmethyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(1,2-oxazol-5-ylmethyl)propanamide |
|---|---|
| PubChem CID | 106423353 |
| Molecular Formula | C7H5F5N2O2 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(1,2-oxazol-5-ylmethyl)propanamide |
| SMILES | O=C(NCc1ccno1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O2/c8-6(9,7(10,11)12)5(15)13-3-4-1-2-14-16-4/h1-2H,3H2,(H,13,15) |
| InChIKey | PVSXHICSURQJHX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|