C10H12BrF3N2O2S2 — CID 106425771
3-amino-5-bromo-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106425771) has the molecular formula C10H12BrF3N2O2S2 and a molecular weight of 393.25 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106425771 |
| Molecular Formula | C10H12BrF3N2O2S2 |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2O2S2/c1-6-8(15)4-7(11)5-9(6)20(17,18)16-2-3-19-10(12,13)14/h4-5,16H,2-3,15H2,1H3 |
| InChIKey | STAUJRCGPAIDIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|