C11H24N2S — CID 106425804
2-propan-2-yl-N'-(2-prop-2-enylsulfanylethyl)propane-1,3-diamine (PubChem CID 106425804) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 2-propan-2-yl-N'-(2-prop-2-enylsulfanylethyl)propane-1,3-diamine.
| Compound Name | 2-propan-2-yl-N'-(2-prop-2-enylsulfanylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 106425804 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-propan-2-yl-N'-(2-prop-2-enylsulfanylethyl)propane-1,3-diamine |
| SMILES | C=CCSCCNCC(CN)C(C)C |
| InChI | InChI=1S/C11H24N2S/c1-4-6-14-7-5-13-9-11(8-12)10(2)3/h4,10-11,13H,1,5-9,12H2,2-3H3 |
| InChIKey | YVVZFRXUUZUBOK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|