C8H13N3S2 — CID 106426054
2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine (PubChem CID 106426054) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 106426054 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine |
| SMILES | C=CCSCCNc1ncc(N)s1 |
| InChI | InChI=1S/C8H13N3S2/c1-2-4-12-5-3-10-8-11-6-7(9)13-8/h2,6H,1,3-5,9H2,(H,10,11) |
| InChIKey | NUNSXAZSFAPQRT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|