About 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine
2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine (PubChem CID 106426054) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine |
| PubChem CID | 106426054 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine |
| SMILES | C=CCSCCNc1ncc(N)s1 |
| InChI | InChI=1S/C8H13N3S2/c1-2-4-12-5-3-10-8-11-6-7(9)13-8/h2,6H,1,3-5,9H2,(H,10,11) |
| InChIKey | NUNSXAZSFAPQRT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine?
The IUPAC name of 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine (CID 106426054) is 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine.
What is the SMILES notation for 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine?
The canonical SMILES for 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine is C=CCSCCNc1ncc(N)s1.
What is the InChIKey of 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine?
The InChIKey is NUNSXAZSFAPQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c1-2-4-12-5-3-10-8-11-6-7(9)13-8/h2,6H,1,3-5,9H2,(H,10,11).
What are the key properties of 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine?
2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine has a molecular weight of 215.35 g/mol, XLogP of 2.06, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-2,5-diamine is sourced from PubChem (CID 106426054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).