C10H14F3NO3S — CID 106426746
cis-(1R,3S)-2,2-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 106426746) has the molecular formula C10H14F3NO3S and a molecular weight of 285.29 g/mol. Its IUPAC name is cis-(1R,3S)-2,2-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-2,2-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 106426746 |
| Molecular Formula | C10H14F3NO3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | cis-(1R,3S)-2,2-dimethyl-3-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)[C@@H]1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3S/c1-9(2)5(6(9)8(16)17)7(15)14-3-4-18-10(11,12)13/h5-6H,3-4H2,1-2H3,(H,14,15)(H,16,17)/t5-,6+/m1/s1 |
| InChIKey | FYUHVNBKRUTIOH-RITPCOANSA-N |
| XLogP | 1.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|