C11H17F3N2OS — CID 106427350
N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 106427350) has the molecular formula C11H17F3N2OS and a molecular weight of 282.33 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106427350 |
| Molecular Formula | C11H17F3N2OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(2-prop-2-enylsulfanylethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | C=CCSCCNC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H17F3N2OS/c1-2-6-18-7-5-16-9(17)10(11(12,13)14)3-4-15-8-10/h2,15H,1,3-8H2,(H,16,17) |
| InChIKey | UYGARAIOUNNQMF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|