About N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide
N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide (PubChem CID 10642736) has the molecular formula C21H21NO3S
and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| PubChem CID | 10642736 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-16-12-14-19(15-13-16)26(24,25)22-20(17-8-4-2-5-9-17)21(23)18-10-6-3-7-11-18/h2-15,20-23H,1H3/t20-,21+/m0/s1 |
| InChIKey | URVQPPFOCBAUNE-LEWJYISDSA-N |
| XLogP | 3.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide (CID 10642736) is N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)[C@H](O)c2ccccc2)cc1.
What is the InChIKey of N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide?
The InChIKey is URVQPPFOCBAUNE-LEWJYISDSA-N. The full InChI is InChI=1S/C21H21NO3S/c1-16-12-14-19(15-13-16)26(24,25)22-20(17-8-4-2-5-9-17)21(23)18-10-6-3-7-11-18/h2-15,20-23H,1H3/t20-,21+/m0/s1.
What are the key properties of N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide?
N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide has a molecular weight of 367.47 g/mol, XLogP of 3.75, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-hydroxy-1,2-diphenylethyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 10642736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).