C24H33NO2 — CID 10642746
(1R,2S,4R,6R,7S,10S,11S,14S,16S)-7,11-dimethyl-6-pyridin-3-yl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-ol (PubChem CID 10642746) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (1R,2S,4R,6R,7S,10S,11S,14S,16S)-7,11-dimethyl-6-pyridin-3-yl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-ol.
| Compound Name | (1R,2S,4R,6R,7S,10S,11S,14S,16S)-7,11-dimethyl-6-pyridin-3-yl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-ol |
|---|---|
| PubChem CID | 10642746 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (1R,2S,4R,6R,7S,10S,11S,14S,16S)-7,11-dimethyl-6-pyridin-3-yl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-14-ol |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@H]1O[C@]12c1cccnc1 |
| InChI | InChI=1S/C24H33NO2/c1-22-9-7-17(26)12-15(22)5-6-18-19(22)8-10-23(2)20(18)13-21-24(23,27-21)16-4-3-11-25-14-16/h3-4,11,14-15,17-21,26H,5-10,12-13H2,1-2H3/t15-,17-,18+,19-,20-,21+,22-,23-,24+/m0/s1 |
| InChIKey | HCDOTKKMWJSPAV-FFIDVGPSSA-N |
| XLogP | 4.69 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|