C16H8F4N2O4 — CID 10642764
4,5,6,7-tetrafluoro-2-[(1S)-1-(4-nitrophenyl)ethyl]isoindole-1,3-dione (PubChem CID 10642764) has the molecular formula C16H8F4N2O4 and a molecular weight of 368.24 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[(1S)-1-(4-nitrophenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-2-[(1S)-1-(4-nitrophenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10642764 |
| Molecular Formula | C16H8F4N2O4 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[(1S)-1-(4-nitrophenyl)ethyl]isoindole-1,3-dione |
| SMILES | C[C@@H](c1ccc([N+](=O)[O-])cc1)N1C(=O)c2c(F)c(F)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C16H8F4N2O4/c1-6(7-2-4-8(5-3-7)22(25)26)21-15(23)9-10(16(21)24)12(18)14(20)13(19)11(9)17/h2-6H,1H3/t6-/m0/s1 |
| InChIKey | LMPBCAWBSORYSZ-LURJTMIESA-N |
| XLogP | 3.51 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|