C10H13F3N4OS — CID 106428125
N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 106428125) has the molecular formula C10H13F3N4OS and a molecular weight of 294.30 g/mol. Its IUPAC name is N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 106428125 |
| Molecular Formula | C10H13F3N4OS |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[2-(trifluoromethylsulfanyl)ethyl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C10H13F3N4OS/c11-10(12,13)19-2-1-14-9(18)7-3-6-8(4-15-7)17-5-16-6/h5,7,15H,1-4H2,(H,14,18)(H,16,17) |
| InChIKey | WMOPICRGHOZUPA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|