About ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate
ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate (PubChem CID 10642824) has the molecular formula C19H19N3O5
and a molecular weight of 369.38 g/mol. Its IUPAC name is ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate |
| PubChem CID | 10642824 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate |
| SMILES | CCOC(=O)n1cnc([C@H]2CC[C@@H](CN3C(=O)c4ccccc4C3=O)O2)c1 |
| InChI | InChI=1S/C19H19N3O5/c1-2-26-19(25)21-10-15(20-11-21)16-8-7-12(27-16)9-22-17(23)13-5-3-4-6-14(13)18(22)24/h3-6,10-12,16H,2,7-9H2,1H3/t12-,16+/m0/s1 |
| InChIKey | PMBKSOSAQCQVBX-BLLLJJGKSA-N |
| XLogP | 2.40 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate?
The IUPAC name of ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate (CID 10642824) is ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate.
What is the SMILES notation for ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate?
The canonical SMILES for ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate is CCOC(=O)n1cnc([C@H]2CC[C@@H](CN3C(=O)c4ccccc4C3=O)O2)c1.
What is the InChIKey of ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate?
The InChIKey is PMBKSOSAQCQVBX-BLLLJJGKSA-N. The full InChI is InChI=1S/C19H19N3O5/c1-2-26-19(25)21-10-15(20-11-21)16-8-7-12(27-16)9-22-17(23)13-5-3-4-6-14(13)18(22)24/h3-6,10-12,16H,2,7-9H2,1H3/t12-,16+/m0/s1.
What are the key properties of ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate?
ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate has a molecular weight of 369.38 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2R,5S)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate is sourced from PubChem (CID 10642824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).