C13H23F3N2OS — CID 106428319
4-amino-2,2,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 106428319) has the molecular formula C13H23F3N2OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-amino-2,2,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-2,2,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106428319 |
| Molecular Formula | C13H23F3N2OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-amino-2,2,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC1C(N)CCC(C(=O)NCCSC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C13H23F3N2OS/c1-8-10(17)5-4-9(12(8,2)3)11(19)18-6-7-20-13(14,15)16/h8-10H,4-7,17H2,1-3H3,(H,18,19) |
| InChIKey | YLXNJDXVMKDBSV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|