About 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione
1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione (PubChem CID 106429204) has the molecular formula C10H14F3N3O2S
and a molecular weight of 297.30 g/mol. Its IUPAC name is 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione |
| PubChem CID | 106429204 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(CNCCSC(F)(F)F)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C10H14F3N3O2S/c1-15-7(5-8(17)16(2)9(15)18)6-14-3-4-19-10(11,12)13/h5,14H,3-4,6H2,1-2H3 |
| InChIKey | NLRGPRWYJCTDPZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione?
The IUPAC name of 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione (CID 106429204) is 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione?
The canonical SMILES for 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione is Cn1c(CNCCSC(F)(F)F)cc(=O)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione?
The InChIKey is NLRGPRWYJCTDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O2S/c1-15-7(5-8(17)16(2)9(15)18)6-14-3-4-19-10(11,12)13/h5,14H,3-4,6H2,1-2H3.
What are the key properties of 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione?
1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione has a molecular weight of 297.30 g/mol, XLogP of 0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 106429204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).