C18H38N6O2 — CID 10642926
1-N,7-N-dibutyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxamide (PubChem CID 10642926) has the molecular formula C18H38N6O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-N,7-N-dibutyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxamide.
| Compound Name | 1-N,7-N-dibutyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxamide |
|---|---|
| PubChem CID | 10642926 |
| Molecular Formula | C18H38N6O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 1-N,7-N-dibutyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxamide |
| SMILES | CCCCNC(=O)N1CCNCCN(C(=O)NCCCC)CCNCC1 |
| InChI | InChI=1S/C18H38N6O2/c1-3-5-7-21-17(25)23-13-9-19-11-15-24(16-12-20-10-14-23)18(26)22-8-6-4-2/h19-20H,3-16H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | OHZHGUKCFGNCOQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|