C11H11BrN2O2S — CID 106429424
5-bromo-2-(2-prop-2-ynylsulfanylethylamino)pyridine-3-carboxylic acid (PubChem CID 106429424) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is 5-bromo-2-(2-prop-2-ynylsulfanylethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-bromo-2-(2-prop-2-ynylsulfanylethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106429424 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 5-bromo-2-(2-prop-2-ynylsulfanylethylamino)pyridine-3-carboxylic acid |
| SMILES | C#CCSCCNc1ncc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H11BrN2O2S/c1-2-4-17-5-3-13-10-9(11(15)16)6-8(12)7-14-10/h1,6-7H,3-5H2,(H,13,14)(H,15,16) |
| InChIKey | ZUGYDNIIVPKZMH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|