C12H19NOS — CID 106429760
2,3-dimethyl-1-(2-prop-2-ynylsulfanylethyl)piperidin-4-one (PubChem CID 106429760) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2-prop-2-ynylsulfanylethyl)piperidin-4-one.
| Compound Name | 2,3-dimethyl-1-(2-prop-2-ynylsulfanylethyl)piperidin-4-one |
|---|---|
| PubChem CID | 106429760 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2,3-dimethyl-1-(2-prop-2-ynylsulfanylethyl)piperidin-4-one |
| SMILES | C#CCSCCN1CCC(=O)C(C)C1C |
| InChI | InChI=1S/C12H19NOS/c1-4-8-15-9-7-13-6-5-12(14)10(2)11(13)3/h1,10-11H,5-9H2,2-3H3 |
| InChIKey | HQJAVCVQXIHKFE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|