C11H21F3N2S — CID 106429808
N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidin-3-yl]methyl]propan-2-amine (PubChem CID 106429808) has the molecular formula C11H21F3N2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106429808 |
| Molecular Formula | C11H21F3N2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1CCN(CCSC(F)(F)F)C1 |
| InChI | InChI=1S/C11H21F3N2S/c1-9(2)15-7-10-3-4-16(8-10)5-6-17-11(12,13)14/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | WWZLTUCUGGVARO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |