C17H11Cl2N5O — CID 10642998
2,4-diamino-10-(2,4-dichlorophenyl)pyrimido[4,5-b]quinolin-5-one (PubChem CID 10642998) has the molecular formula C17H11Cl2N5O and a molecular weight of 372.22 g/mol. Its IUPAC name is 2,4-diamino-10-(2,4-dichlorophenyl)pyrimido[4,5-b]quinolin-5-one.
| Compound Name | 2,4-diamino-10-(2,4-dichlorophenyl)pyrimido[4,5-b]quinolin-5-one |
|---|---|
| PubChem CID | 10642998 |
| Molecular Formula | C17H11Cl2N5O |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2,4-diamino-10-(2,4-dichlorophenyl)pyrimido[4,5-b]quinolin-5-one |
| SMILES | Nc1nc(N)c2c(=O)c3ccccc3n(-c3ccc(Cl)cc3Cl)c2n1 |
| InChI | InChI=1S/C17H11Cl2N5O/c18-8-5-6-12(10(19)7-8)24-11-4-2-1-3-9(11)14(25)13-15(20)22-17(21)23-16(13)24/h1-7H,(H4,20,21,22,23) |
| InChIKey | JKUDQOCXYZYSBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|