C9H10F3N3O2S — CID 106430029
4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-5-carboxylic acid (PubChem CID 106430029) has the molecular formula C9H10F3N3O2S and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 106430029 |
| Molecular Formula | C9H10F3N3O2S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCCSC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O2S/c10-9(11,12)18-2-1-13-4-7-6(8(16)17)3-14-5-15-7/h3,5,13H,1-2,4H2,(H,16,17) |
| InChIKey | VPCYNXZFXXFGPZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|