C8H12F3NO2S — CID 106430123
2-methyl-4-[2-(trifluoromethylsulfanyl)ethylamino]but-2-enoic acid (PubChem CID 106430123) has the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-methyl-4-[2-(trifluoromethylsulfanyl)ethylamino]but-2-enoic acid.
| Compound Name | 2-methyl-4-[2-(trifluoromethylsulfanyl)ethylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106430123 |
| Molecular Formula | C8H12F3NO2S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-methyl-4-[2-(trifluoromethylsulfanyl)ethylamino]but-2-enoic acid |
| SMILES | CC(=CCNCCSC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H12F3NO2S/c1-6(7(13)14)2-3-12-4-5-15-8(9,10)11/h2,12H,3-5H2,1H3,(H,13,14) |
| InChIKey | LVOZUXJGWWKLHH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|