C12H17F3N2O3S — CID 106430438
1-(2-prop-2-enylsulfanylethylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 106430438) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is 1-(2-prop-2-enylsulfanylethylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-prop-2-enylsulfanylethylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106430438 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(2-prop-2-enylsulfanylethylcarbamoyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CCSCCNC(=O)N1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H17F3N2O3S/c1-2-6-21-7-4-16-10(20)17-5-3-11(8-17,9(18)19)12(13,14)15/h2H,1,3-8H2,(H,16,20)(H,18,19) |
| InChIKey | AYRKBXHMFSZQOM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|