About N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine
N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 106430517) has the molecular formula C8H8F3N3S2
and a molecular weight of 267.30 g/mol. Its IUPAC name is N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 106430517 |
| Molecular Formula | C8H8F3N3S2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | C#CCSCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C8H8F3N3S2/c1-2-4-15-5-3-12-7-13-6(14-16-7)8(9,10)11/h1H,3-5H2,(H,12,13,14) |
| InChIKey | VNTPEVDDTUQBQO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (CID 106430517) is N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine is C#CCSCCNc1nc(C(F)(F)F)ns1.
What is the InChIKey of N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is VNTPEVDDTUQBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3S2/c1-2-4-15-5-3-12-7-13-6(14-16-7)8(9,10)11/h1H,3-5H2,(H,12,13,14).
What are the key properties of N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 267.30 g/mol, XLogP of 2.34, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-prop-2-ynylsulfanylethyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 106430517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).