C11H11FN4S — CID 106430620
6-fluoro-N-(2-prop-2-ynylsulfanylethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 106430620) has the molecular formula C11H11FN4S and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-fluoro-N-(2-prop-2-ynylsulfanylethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-fluoro-N-(2-prop-2-ynylsulfanylethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 106430620 |
| Molecular Formula | C11H11FN4S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 6-fluoro-N-(2-prop-2-ynylsulfanylethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C#CCSCCNc1nc2ccc(F)cn2n1 |
| InChI | InChI=1S/C11H11FN4S/c1-2-6-17-7-5-13-11-14-10-4-3-9(12)8-16(10)15-11/h1,3-4,8H,5-7H2,(H,13,15) |
| InChIKey | NTVGDJCPXBBAOI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|