C11H18F3N3O3S — CID 106431339
2-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]piperazin-1-yl]propanoic acid (PubChem CID 106431339) has the molecular formula C11H18F3N3O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]piperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 106431339 |
| Molecular Formula | C11H18F3N3O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[4-[2-(trifluoromethylsulfanyl)ethylcarbamoyl]piperazin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCN(C(=O)NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3N3O3S/c1-8(9(18)19)16-3-5-17(6-4-16)10(20)15-2-7-21-11(12,13)14/h8H,2-7H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | QBDLBLQBJBGDLS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|